C12H13NO3 — CID 115866504
6-[(but-2-ynylamino)methyl]-1,3-benzodioxol-5-ol (PubChem CID 115866504) has the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. Its IUPAC name is 6-[(but-2-ynylamino)methyl]-1,3-benzodioxol-5-ol.
| Compound Name | 6-[(but-2-ynylamino)methyl]-1,3-benzodioxol-5-ol |
|---|---|
| PubChem CID | 115866504 |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | 6-[(but-2-ynylamino)methyl]-1,3-benzodioxol-5-ol |
| SMILES | CC#CCNCc1cc2c(cc1O)OCO2 |
| InChI | InChI=1S/C12H13NO3/c1-2-3-4-13-7-9-5-11-12(6-10(9)14)16-8-15-11/h5-6,13-14H,4,7-8H2,1H3 |
| InChIKey | BFDNNZQYRSTVBE-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|