C13H13NO4 — CID 113229742
6-[(furan-3-ylmethylamino)methyl]-1,3-benzodioxol-5-ol (PubChem CID 113229742) has the molecular formula C13H13NO4 and a molecular weight of 247.25 g/mol. Its IUPAC name is 6-[(furan-3-ylmethylamino)methyl]-1,3-benzodioxol-5-ol.
| Compound Name | 6-[(furan-3-ylmethylamino)methyl]-1,3-benzodioxol-5-ol |
|---|---|
| PubChem CID | 113229742 |
| Molecular Formula | C13H13NO4 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | 6-[(furan-3-ylmethylamino)methyl]-1,3-benzodioxol-5-ol |
| SMILES | Oc1cc2c(cc1CNCc1ccoc1)OCO2 |
| InChI | InChI=1S/C13H13NO4/c15-11-4-13-12(17-8-18-13)3-10(11)6-14-5-9-1-2-16-7-9/h1-4,7,14-15H,5-6,8H2 |
| InChIKey | ARKITTXTLSHOIF-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 63.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|