About 6-[(hexylamino)methyl]-1,3-benzodioxol-5-ol
6-[(hexylamino)methyl]-1,3-benzodioxol-5-ol (PubChem CID 55012501) has the molecular formula C14H21NO3
and a molecular weight of 251.33 g/mol. Its IUPAC name is 6-[(hexylamino)methyl]-1,3-benzodioxol-5-ol.
Molecular Properties
| Compound Name | 6-[(hexylamino)methyl]-1,3-benzodioxol-5-ol |
| PubChem CID | 55012501 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | 6-[(hexylamino)methyl]-1,3-benzodioxol-5-ol |
| SMILES | CCCCCCNCc1cc2c(cc1O)OCO2 |
| InChI | InChI=1S/C14H21NO3/c1-2-3-4-5-6-15-9-11-7-13-14(8-12(11)16)18-10-17-13/h7-8,15-16H,2-6,9-10H2,1H3 |
| InChIKey | UKYVEAITSVENPK-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-[(hexylamino)methyl]-1,3-benzodioxol-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(hexylamino)methyl]-1,3-benzodioxol-5-ol?
The IUPAC name of 6-[(hexylamino)methyl]-1,3-benzodioxol-5-ol (CID 55012501) is 6-[(hexylamino)methyl]-1,3-benzodioxol-5-ol.
What is the SMILES notation for 6-[(hexylamino)methyl]-1,3-benzodioxol-5-ol?
The canonical SMILES for 6-[(hexylamino)methyl]-1,3-benzodioxol-5-ol is CCCCCCNCc1cc2c(cc1O)OCO2.
What is the InChIKey of 6-[(hexylamino)methyl]-1,3-benzodioxol-5-ol?
The InChIKey is UKYVEAITSVENPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO3/c1-2-3-4-5-6-15-9-11-7-13-14(8-12(11)16)18-10-17-13/h7-8,15-16H,2-6,9-10H2,1H3.
What are the key properties of 6-[(hexylamino)methyl]-1,3-benzodioxol-5-ol?
6-[(hexylamino)methyl]-1,3-benzodioxol-5-ol has a molecular weight of 251.33 g/mol, XLogP of 2.79, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(hexylamino)methyl]-1,3-benzodioxol-5-ol is sourced from PubChem (CID 55012501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).