C17H27F2NO — CID 143926672
2-[(decylamino)methyl]-4,6-difluorophenol (PubChem CID 143926672) has the molecular formula C17H27F2NO and a molecular weight of 299.40 g/mol. Its IUPAC name is 2-[(decylamino)methyl]-4,6-difluorophenol.
| Compound Name | 2-[(decylamino)methyl]-4,6-difluorophenol |
|---|---|
| PubChem CID | 143926672 |
| Molecular Formula | C17H27F2NO |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.21 |
| IUPAC Name | 2-[(decylamino)methyl]-4,6-difluorophenol |
| SMILES | CCCCCCCCCCNCc1cc(F)cc(F)c1O |
| InChI | InChI=1S/C17H27F2NO/c1-2-3-4-5-6-7-8-9-10-20-13-14-11-15(18)12-16(19)17(14)21/h11-12,20-21H,2-10,13H2,1H3 |
| InChIKey | MNTIENSIYATHSL-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|