C16H23FN2 — CID 107904656
4-fluoro-2-[(octylamino)methyl]benzonitrile (PubChem CID 107904656) has the molecular formula C16H23FN2 and a molecular weight of 262.37 g/mol. Its IUPAC name is 4-fluoro-2-[(octylamino)methyl]benzonitrile.
| Compound Name | 4-fluoro-2-[(octylamino)methyl]benzonitrile |
|---|---|
| PubChem CID | 107904656 |
| Molecular Formula | C16H23FN2 |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | 4-fluoro-2-[(octylamino)methyl]benzonitrile |
| SMILES | CCCCCCCCNCc1cc(F)ccc1C#N |
| InChI | InChI=1S/C16H23FN2/c1-2-3-4-5-6-7-10-19-13-15-11-16(17)9-8-14(15)12-18/h8-9,11,19H,2-7,10,13H2,1H3 |
| InChIKey | BAGKTXRTFNYPSC-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|