C15H21FN2 — CID 107904704
4-fluoro-2-[(2,3,3-trimethylbutylamino)methyl]benzonitrile (PubChem CID 107904704) has the molecular formula C15H21FN2 and a molecular weight of 248.34 g/mol. Its IUPAC name is 4-fluoro-2-[(2,3,3-trimethylbutylamino)methyl]benzonitrile.
| Compound Name | 4-fluoro-2-[(2,3,3-trimethylbutylamino)methyl]benzonitrile |
|---|---|
| PubChem CID | 107904704 |
| Molecular Formula | C15H21FN2 |
| Molecular Weight | 248.34 g/mol |
| Exact Mass | 248.17 |
| IUPAC Name | 4-fluoro-2-[(2,3,3-trimethylbutylamino)methyl]benzonitrile |
| SMILES | CC(CNCc1cc(F)ccc1C#N)C(C)(C)C |
| InChI | InChI=1S/C15H21FN2/c1-11(15(2,3)4)9-18-10-13-7-14(16)6-5-12(13)8-17/h5-7,11,18H,9-10H2,1-4H3 |
| InChIKey | PNUVKHIOJRRLEA-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.34 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |