C16H24N2O — CID 83143462
4-methoxy-3-[(2,3,3-trimethylbutylamino)methyl]benzonitrile (PubChem CID 83143462) has the molecular formula C16H24N2O and a molecular weight of 260.38 g/mol. Its IUPAC name is 4-methoxy-3-[(2,3,3-trimethylbutylamino)methyl]benzonitrile.
| Compound Name | 4-methoxy-3-[(2,3,3-trimethylbutylamino)methyl]benzonitrile |
|---|---|
| PubChem CID | 83143462 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | 4-methoxy-3-[(2,3,3-trimethylbutylamino)methyl]benzonitrile |
| SMILES | COc1ccc(C#N)cc1CNCC(C)C(C)(C)C |
| InChI | InChI=1S/C16H24N2O/c1-12(16(2,3)4)10-18-11-14-8-13(9-17)6-7-15(14)19-5/h6-8,12,18H,10-11H2,1-5H3 |
| InChIKey | KIXSZFUKIZVEHT-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |