C18H27FN2 — CID 107904517
2-[(decylamino)methyl]-4-fluorobenzonitrile (PubChem CID 107904517) has the molecular formula C18H27FN2 and a molecular weight of 290.43 g/mol. Its IUPAC name is 2-[(decylamino)methyl]-4-fluorobenzonitrile.
| Compound Name | 2-[(decylamino)methyl]-4-fluorobenzonitrile |
|---|---|
| PubChem CID | 107904517 |
| Molecular Formula | C18H27FN2 |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | 2-[(decylamino)methyl]-4-fluorobenzonitrile |
| SMILES | CCCCCCCCCCNCc1cc(F)ccc1C#N |
| InChI | InChI=1S/C18H27FN2/c1-2-3-4-5-6-7-8-9-12-21-15-17-13-18(19)11-10-16(17)14-20/h10-11,13,21H,2-9,12,15H2,1H3 |
| InChIKey | ZNDSSZMREMJXLC-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|