C14H15NO4 — CID 55012877
6-[[2-(furan-2-yl)ethylamino]methyl]-1,3-benzodioxol-5-ol (PubChem CID 55012877) has the molecular formula C14H15NO4 and a molecular weight of 261.28 g/mol. Its IUPAC name is 6-[[2-(furan-2-yl)ethylamino]methyl]-1,3-benzodioxol-5-ol.
| Compound Name | 6-[[2-(furan-2-yl)ethylamino]methyl]-1,3-benzodioxol-5-ol |
|---|---|
| PubChem CID | 55012877 |
| Molecular Formula | C14H15NO4 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 6-[[2-(furan-2-yl)ethylamino]methyl]-1,3-benzodioxol-5-ol |
| SMILES | Oc1cc2c(cc1CNCCc1ccco1)OCO2 |
| InChI | InChI=1S/C14H15NO4/c16-12-7-14-13(18-9-19-14)6-10(12)8-15-4-3-11-2-1-5-17-11/h1-2,5-7,15-16H,3-4,8-9H2 |
| InChIKey | FNIJISLHXSULKJ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 63.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|