C13H13Cl2NO — CID 65315812
N-[(2,5-dichlorophenyl)methyl]-2-(furan-2-yl)ethanamine (PubChem CID 65315812) has the molecular formula C13H13Cl2NO and a molecular weight of 270.16 g/mol. Its IUPAC name is N-[(2,5-dichlorophenyl)methyl]-2-(furan-2-yl)ethanamine.
| Compound Name | N-[(2,5-dichlorophenyl)methyl]-2-(furan-2-yl)ethanamine |
|---|---|
| PubChem CID | 65315812 |
| Molecular Formula | C13H13Cl2NO |
| Molecular Weight | 270.16 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | N-[(2,5-dichlorophenyl)methyl]-2-(furan-2-yl)ethanamine |
| SMILES | Clc1ccc(Cl)c(CNCCc2ccco2)c1 |
| InChI | InChI=1S/C13H13Cl2NO/c14-11-3-4-13(15)10(8-11)9-16-6-5-12-2-1-7-17-12/h1-4,7-8,16H,5-6,9H2 |
| InChIKey | KWVXGZBHQXZLDI-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.16 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|