C15H22N2O4S — CID 107237251
tert-butyl N-[(6-methylsulfanyl-2,3-dihydro-1,4-benzodioxin-7-yl)methylamino]carbamate (PubChem CID 107237251) has the molecular formula C15H22N2O4S and a molecular weight of 326.42 g/mol. Its IUPAC name is tert-butyl N-[(6-methylsulfanyl-2,3-dihydro-1,4-benzodioxin-7-yl)methylamino]carbamate.
| Compound Name | tert-butyl N-[(6-methylsulfanyl-2,3-dihydro-1,4-benzodioxin-7-yl)methylamino]carbamate |
|---|---|
| PubChem CID | 107237251 |
| Molecular Formula | C15H22N2O4S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | tert-butyl N-[(6-methylsulfanyl-2,3-dihydro-1,4-benzodioxin-7-yl)methylamino]carbamate |
| SMILES | CSc1cc2c(cc1CNNC(=O)OC(C)(C)C)OCCO2 |
| InChI | InChI=1S/C15H22N2O4S/c1-15(2,3)21-14(18)17-16-9-10-7-11-12(8-13(10)22-4)20-6-5-19-11/h7-8,16H,5-6,9H2,1-4H3,(H,17,18) |
| InChIKey | YIZCRIKXHWUATQ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|