C13H16BrNO4 — CID 53349637
tert-butyl N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]carbamate (PubChem CID 53349637) has the molecular formula C13H16BrNO4 and a molecular weight of 330.18 g/mol. Its IUPAC name is tert-butyl N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]carbamate.
| Compound Name | tert-butyl N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]carbamate |
|---|---|
| PubChem CID | 53349637 |
| Molecular Formula | C13H16BrNO4 |
| Molecular Weight | 330.18 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | tert-butyl N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1cc2c(cc1Br)OCO2 |
| InChI | InChI=1S/C13H16BrNO4/c1-13(2,3)19-12(16)15-6-8-4-10-11(5-9(8)14)18-7-17-10/h4-5H,6-7H2,1-3H3,(H,15,16) |
| InChIKey | WEOJGCPSBHNBSZ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.18 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |