C13H19BN2O4 — CID 139593300
tert-butyl N-[(6-amino-1-hydroxy-3H-2,1-benzoxaborol-4-yl)methyl]carbamate (PubChem CID 139593300) has the molecular formula C13H19BN2O4 and a molecular weight of 278.12 g/mol. Its IUPAC name is tert-butyl N-[(6-amino-1-hydroxy-3H-2,1-benzoxaborol-4-yl)methyl]carbamate.
| Compound Name | tert-butyl N-[(6-amino-1-hydroxy-3H-2,1-benzoxaborol-4-yl)methyl]carbamate |
|---|---|
| PubChem CID | 139593300 |
| Molecular Formula | C13H19BN2O4 |
| Molecular Weight | 278.12 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | tert-butyl N-[(6-amino-1-hydroxy-3H-2,1-benzoxaborol-4-yl)methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1cc(N)cc2c1COB2O |
| InChI | InChI=1S/C13H19BN2O4/c1-13(2,3)20-12(17)16-6-8-4-9(15)5-11-10(8)7-19-14(11)18/h4-5,18H,6-7,15H2,1-3H3,(H,16,17) |
| InChIKey | LFRGITLBRDHAOF-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.12 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|