C13H17F3N2O2 — CID 171666541
tert-butyl N-[[2-amino-5-(trifluoromethyl)phenyl]methyl]carbamate (PubChem CID 171666541) has the molecular formula C13H17F3N2O2 and a molecular weight of 290.28 g/mol. Its IUPAC name is tert-butyl N-[[2-amino-5-(trifluoromethyl)phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[2-amino-5-(trifluoromethyl)phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 171666541 |
| Molecular Formula | C13H17F3N2O2 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | tert-butyl N-[[2-amino-5-(trifluoromethyl)phenyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1cc(C(F)(F)F)ccc1N |
| InChI | InChI=1S/C13H17F3N2O2/c1-12(2,3)20-11(19)18-7-8-6-9(13(14,15)16)4-5-10(8)17/h4-6H,7,17H2,1-3H3,(H,18,19) |
| InChIKey | JGNDWIOSILJKKW-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|