C19H28N4O2 — CID 159590689
2-(aminomethyl)aniline;tert-butyl N-[(2-aminophenyl)methyl]carbamate (PubChem CID 159590689) has the molecular formula C19H28N4O2 and a molecular weight of 344.46 g/mol. Its IUPAC name is 2-(aminomethyl)aniline;tert-butyl N-[(2-aminophenyl)methyl]carbamate.
| Compound Name | 2-(aminomethyl)aniline;tert-butyl N-[(2-aminophenyl)methyl]carbamate |
|---|---|
| PubChem CID | 159590689 |
| Molecular Formula | C19H28N4O2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | 2-(aminomethyl)aniline;tert-butyl N-[(2-aminophenyl)methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1ccccc1N.NCc1ccccc1N |
| InChI | InChI=1S/C12H18N2O2.C7H10N2/c1-12(2,3)16-11(15)14-8-9-6-4-5-7-10(9)13;8-5-6-3-1-2-4-7(6)9/h4-7H,8,13H2,1-3H3,(H,14,15);1-4H,5,8-9H2 |
| InChIKey | MKEWRBCIJOXGQR-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 116.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|