C13H16LiNO4 — CID 170591077
lithium 2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]benzoate (PubChem CID 170591077) has the molecular formula C13H16LiNO4 and a molecular weight of 257.21 g/mol. Its IUPAC name is lithium 2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]benzoate.
| Compound Name | lithium 2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]benzoate |
|---|---|
| PubChem CID | 170591077 |
| Molecular Formula | C13H16LiNO4 |
| Molecular Weight | 257.21 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | lithium 2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]benzoate |
| SMILES | CC(C)(C)OC(=O)NCc1ccccc1C(=O)[O-].[Li+] |
| InChI | InChI=1S/C13H17NO4.Li/c1-13(2,3)18-12(17)14-8-9-6-4-5-7-10(9)11(15)16;/h4-7H,8H2,1-3H3,(H,14,17)(H,15,16);/q;+1/p-1 |
| InChIKey | YWJDIDVNCAYXNT-UHFFFAOYSA-M |
| XLogP | -1.92 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.21 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |