C14H17NO6 — CID 67230375
3-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phthalic acid (PubChem CID 67230375) has the molecular formula C14H17NO6 and a molecular weight of 295.29 g/mol. Its IUPAC name is 3-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phthalic acid.
| Compound Name | 3-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phthalic acid |
|---|---|
| PubChem CID | 67230375 |
| Molecular Formula | C14H17NO6 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 3-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phthalic acid |
| SMILES | CC(C)(C)OC(=O)NCc1cccc(C(=O)O)c1C(=O)O |
| InChI | InChI=1S/C14H17NO6/c1-14(2,3)21-13(20)15-7-8-5-4-6-9(11(16)17)10(8)12(18)19/h4-6H,7H2,1-3H3,(H,15,20)(H,16,17)(H,18,19) |
| InChIKey | PJPWXQCEKYZVPP-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |