C13H20ClNO3 — CID 174676513
tert-butyl N-[(2-methoxyphenyl)methyl]carbamate;hydrochloride (PubChem CID 174676513) has the molecular formula C13H20ClNO3 and a molecular weight of 273.76 g/mol. Its IUPAC name is tert-butyl N-[(2-methoxyphenyl)methyl]carbamate;hydrochloride.
| Compound Name | tert-butyl N-[(2-methoxyphenyl)methyl]carbamate;hydrochloride |
|---|---|
| PubChem CID | 174676513 |
| Molecular Formula | C13H20ClNO3 |
| Molecular Weight | 273.76 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | tert-butyl N-[(2-methoxyphenyl)methyl]carbamate;hydrochloride |
| SMILES | COc1ccccc1CNC(=O)OC(C)(C)C.Cl |
| InChI | InChI=1S/C13H19NO3.ClH/c1-13(2,3)17-12(15)14-9-10-7-5-6-8-11(10)16-4;/h5-8H,9H2,1-4H3,(H,14,15);1H |
| InChIKey | HPDRKKVXZJUSLX-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.76 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |