C22H29N3O4 — CID 91280373
tert-butyl N-[2-[3-[(2-methoxyphenyl)methylcarbamoylamino]phenyl]ethyl]carbamate (PubChem CID 91280373) has the molecular formula C22H29N3O4 and a molecular weight of 399.49 g/mol. Its IUPAC name is tert-butyl N-[2-[3-[(2-methoxyphenyl)methylcarbamoylamino]phenyl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[3-[(2-methoxyphenyl)methylcarbamoylamino]phenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 91280373 |
| Molecular Formula | C22H29N3O4 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | tert-butyl N-[2-[3-[(2-methoxyphenyl)methylcarbamoylamino]phenyl]ethyl]carbamate |
| SMILES | COc1ccccc1CNC(=O)Nc1cccc(CCNC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C22H29N3O4/c1-22(2,3)29-21(27)23-13-12-16-8-7-10-18(14-16)25-20(26)24-15-17-9-5-6-11-19(17)28-4/h5-11,14H,12-13,15H2,1-4H3,(H,23,27)(H2,24,25,26) |
| InChIKey | OCMIHUHKNCLHRQ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |