C25H35N3O3 — CID 86650505
tert-butyl N-[2-[3-[(4-tert-butylphenyl)methylcarbamoylamino]phenyl]ethyl]carbamate (PubChem CID 86650505) has the molecular formula C25H35N3O3 and a molecular weight of 425.57 g/mol. Its IUPAC name is tert-butyl N-[2-[3-[(4-tert-butylphenyl)methylcarbamoylamino]phenyl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[3-[(4-tert-butylphenyl)methylcarbamoylamino]phenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 86650505 |
| Molecular Formula | C25H35N3O3 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.27 |
| IUPAC Name | tert-butyl N-[2-[3-[(4-tert-butylphenyl)methylcarbamoylamino]phenyl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCc1cccc(NC(=O)NCc2ccc(C(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C25H35N3O3/c1-24(2,3)20-12-10-19(11-13-20)17-27-22(29)28-21-9-7-8-18(16-21)14-15-26-23(30)31-25(4,5)6/h7-13,16H,14-15,17H2,1-6H3,(H,26,30)(H2,27,28,29) |
| InChIKey | CZDFMQPIGZIEPL-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |