C21H27N3O4 — CID 91250750
tert-butyl N-[2-[3-[(4-methoxyphenyl)carbamoylamino]phenyl]ethyl]carbamate (PubChem CID 91250750) has the molecular formula C21H27N3O4 and a molecular weight of 385.46 g/mol. Its IUPAC name is tert-butyl N-[2-[3-[(4-methoxyphenyl)carbamoylamino]phenyl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[3-[(4-methoxyphenyl)carbamoylamino]phenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 91250750 |
| Molecular Formula | C21H27N3O4 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | tert-butyl N-[2-[3-[(4-methoxyphenyl)carbamoylamino]phenyl]ethyl]carbamate |
| SMILES | COc1ccc(NC(=O)Nc2cccc(CCNC(=O)OC(C)(C)C)c2)cc1 |
| InChI | InChI=1S/C21H27N3O4/c1-21(2,3)28-20(26)22-13-12-15-6-5-7-17(14-15)24-19(25)23-16-8-10-18(27-4)11-9-16/h5-11,14H,12-13H2,1-4H3,(H,22,26)(H2,23,24,25) |
| InChIKey | CLOULKSXRBQFLC-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |