C17H27NO2 — CID 139689119
tert-butyl N-[3-(3,3-dimethylbutyl)phenyl]carbamate (PubChem CID 139689119) has the molecular formula C17H27NO2 and a molecular weight of 277.41 g/mol. Its IUPAC name is tert-butyl N-[3-(3,3-dimethylbutyl)phenyl]carbamate.
| Compound Name | tert-butyl N-[3-(3,3-dimethylbutyl)phenyl]carbamate |
|---|---|
| PubChem CID | 139689119 |
| Molecular Formula | C17H27NO2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | tert-butyl N-[3-(3,3-dimethylbutyl)phenyl]carbamate |
| SMILES | CC(C)(C)CCc1cccc(NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C17H27NO2/c1-16(2,3)11-10-13-8-7-9-14(12-13)18-15(19)20-17(4,5)6/h7-9,12H,10-11H2,1-6H3,(H,18,19) |
| InChIKey | FIWSFYFTDXBCHP-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |