C13H18N2O4 — CID 174964106
tert-butyl N-[3-(carbamoyloxymethyl)phenyl]carbamate (PubChem CID 174964106) has the molecular formula C13H18N2O4 and a molecular weight of 266.30 g/mol. Its IUPAC name is tert-butyl N-[3-(carbamoyloxymethyl)phenyl]carbamate.
| Compound Name | tert-butyl N-[3-(carbamoyloxymethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 174964106 |
| Molecular Formula | C13H18N2O4 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | tert-butyl N-[3-(carbamoyloxymethyl)phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cccc(COC(N)=O)c1 |
| InChI | InChI=1S/C13H18N2O4/c1-13(2,3)19-12(17)15-10-6-4-5-9(7-10)8-18-11(14)16/h4-7H,8H2,1-3H3,(H2,14,16)(H,15,17) |
| InChIKey | AAPSOCAFEMJYTL-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |