C12H16BF3KNO2 — CID 171374143
potassium trifluoro-[[3-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]methyl]boranuide (PubChem CID 171374143) has the molecular formula C12H16BF3KNO2 and a molecular weight of 313.17 g/mol. Its IUPAC name is potassium trifluoro-[[3-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]methyl]boranuide.
| Compound Name | potassium trifluoro-[[3-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]methyl]boranuide |
|---|---|
| PubChem CID | 171374143 |
| Molecular Formula | C12H16BF3KNO2 |
| Molecular Weight | 313.17 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | potassium trifluoro-[[3-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]methyl]boranuide |
| SMILES | CC(C)(C)OC(=O)Nc1cccc(C[B-](F)(F)F)c1.[K+] |
| InChI | InChI=1S/C12H16BF3NO2.K/c1-12(2,3)19-11(18)17-10-6-4-5-9(7-10)8-13(14,15)16;/h4-7H,8H2,1-3H3,(H,17,18);/q-1;+1 |
| InChIKey | JSJZUEMTJWBPPJ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.17 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|