C16H26N2O2 — CID 107239782
tert-butyl N-[3-(2,2-dimethylpropylamino)phenyl]carbamate (PubChem CID 107239782) has the molecular formula C16H26N2O2 and a molecular weight of 278.40 g/mol. Its IUPAC name is tert-butyl N-[3-(2,2-dimethylpropylamino)phenyl]carbamate.
| Compound Name | tert-butyl N-[3-(2,2-dimethylpropylamino)phenyl]carbamate |
|---|---|
| PubChem CID | 107239782 |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | tert-butyl N-[3-(2,2-dimethylpropylamino)phenyl]carbamate |
| SMILES | CC(C)(C)CNc1cccc(NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C16H26N2O2/c1-15(2,3)11-17-12-8-7-9-13(10-12)18-14(19)20-16(4,5)6/h7-10,17H,11H2,1-6H3,(H,18,19) |
| InChIKey | PWWYJBGMAGOYFS-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |