C24H37N3O8 — CID 138585730
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-[[3-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]methoxycarbonylamino]hexanoic acid (PubChem CID 138585730) has the molecular formula C24H37N3O8 and a molecular weight of 495.57 g/mol. Its IUPAC name is (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-[[3-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]methoxycarbonylamino]hexanoic acid.
| Compound Name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-[[3-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]methoxycarbonylamino]hexanoic acid |
|---|---|
| PubChem CID | 138585730 |
| Molecular Formula | C24H37N3O8 |
| Molecular Weight | 495.57 g/mol |
| Exact Mass | 495.26 |
| IUPAC Name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-[[3-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]methoxycarbonylamino]hexanoic acid |
| SMILES | CC(C)(C)OC(=O)Nc1cccc(COC(=O)NCCCC[C@H](NC(=O)OC(C)(C)C)C(=O)O)c1 |
| InChI | InChI=1S/C24H37N3O8/c1-23(2,3)34-21(31)26-17-11-9-10-16(14-17)15-33-20(30)25-13-8-7-12-18(19(28)29)27-22(32)35-24(4,5)6/h9-11,14,18H,7-8,12-13,15H2,1-6H3,(H,25,30)(H,26,31)(H,27,32)(H,28,29)/t18-/m0/s1 |
| InChIKey | VPDOCNGUSDZWIL-SFHVURJKSA-N |
| XLogP | 4.41 |
| TPSA | 152.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.57 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|