C26H34FN3O5 — CID 118411607
benzyl N-[6-[(3-fluorophenyl)methylamino]-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexyl]carbamate (PubChem CID 118411607) has the molecular formula C26H34FN3O5 and a molecular weight of 487.57 g/mol. Its IUPAC name is benzyl N-[6-[(3-fluorophenyl)methylamino]-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexyl]carbamate.
| Compound Name | benzyl N-[6-[(3-fluorophenyl)methylamino]-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexyl]carbamate |
|---|---|
| PubChem CID | 118411607 |
| Molecular Formula | C26H34FN3O5 |
| Molecular Weight | 487.57 g/mol |
| Exact Mass | 487.25 |
| IUPAC Name | benzyl N-[6-[(3-fluorophenyl)methylamino]-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(CCCCNC(=O)OCc1ccccc1)C(=O)NCc1cccc(F)c1 |
| InChI | InChI=1S/C26H34FN3O5/c1-26(2,3)35-25(33)30-22(23(31)29-17-20-12-9-13-21(27)16-20)14-7-8-15-28-24(32)34-18-19-10-5-4-6-11-19/h4-6,9-13,16,22H,7-8,14-15,17-18H2,1-3H3,(H,28,32)(H,29,31)(H,30,33) |
| InChIKey | WYPLZIYQYMUAOR-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.57 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|