C16H19N3O4S — CID 38215828
1-[3-(methanesulfonamido)phenyl]-3-[(2-methoxyphenyl)methyl]urea (PubChem CID 38215828) has the molecular formula C16H19N3O4S and a molecular weight of 349.41 g/mol. Its IUPAC name is 1-[3-(methanesulfonamido)phenyl]-3-[(2-methoxyphenyl)methyl]urea.
| Compound Name | 1-[3-(methanesulfonamido)phenyl]-3-[(2-methoxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 38215828 |
| Molecular Formula | C16H19N3O4S |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 1-[3-(methanesulfonamido)phenyl]-3-[(2-methoxyphenyl)methyl]urea |
| SMILES | COc1ccccc1CNC(=O)Nc1cccc(NS(C)(=O)=O)c1 |
| InChI | InChI=1S/C16H19N3O4S/c1-23-15-9-4-3-6-12(15)11-17-16(20)18-13-7-5-8-14(10-13)19-24(2,21)22/h3-10,19H,11H2,1-2H3,(H2,17,18,20) |
| InChIKey | BHJOVKOPYPXSGG-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |