C15H15ClN2O2 — CID 976862
1-(3-chlorophenyl)-3-[(2-methoxyphenyl)methyl]urea (PubChem CID 976862) has the molecular formula C15H15ClN2O2 and a molecular weight of 290.75 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[(2-methoxyphenyl)methyl]urea.
| Compound Name | 1-(3-chlorophenyl)-3-[(2-methoxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 976862 |
| Molecular Formula | C15H15ClN2O2 |
| Molecular Weight | 290.75 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[(2-methoxyphenyl)methyl]urea |
| SMILES | COc1ccccc1CNC(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C15H15ClN2O2/c1-20-14-8-3-2-5-11(14)10-17-15(19)18-13-7-4-6-12(16)9-13/h2-9H,10H2,1H3,(H2,17,18,19) |
| InChIKey | VCZULWFBVRFLBT-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.75 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |