C17H20N2O5S — CID 55583363
N-[(2,3-dimethoxyphenyl)methyl]-3-(methanesulfonamido)benzamide (PubChem CID 55583363) has the molecular formula C17H20N2O5S and a molecular weight of 364.42 g/mol. Its IUPAC name is N-[(2,3-dimethoxyphenyl)methyl]-3-(methanesulfonamido)benzamide.
| Compound Name | N-[(2,3-dimethoxyphenyl)methyl]-3-(methanesulfonamido)benzamide |
|---|---|
| PubChem CID | 55583363 |
| Molecular Formula | C17H20N2O5S |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | N-[(2,3-dimethoxyphenyl)methyl]-3-(methanesulfonamido)benzamide |
| SMILES | COc1cccc(CNC(=O)c2cccc(NS(C)(=O)=O)c2)c1OC |
| InChI | InChI=1S/C17H20N2O5S/c1-23-15-9-5-7-13(16(15)24-2)11-18-17(20)12-6-4-8-14(10-12)19-25(3,21)22/h4-10,19H,11H2,1-3H3,(H,18,20) |
| InChIKey | STODPKYFSOSYSD-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |