C18H30N2O4 — CID 159047578
tert-butyl N-[2-[2-[3-(2-aminophenyl)propoxy]ethoxy]ethyl]carbamate (PubChem CID 159047578) has the molecular formula C18H30N2O4 and a molecular weight of 338.45 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[3-(2-aminophenyl)propoxy]ethoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[3-(2-aminophenyl)propoxy]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 159047578 |
| Molecular Formula | C18H30N2O4 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | tert-butyl N-[2-[2-[3-(2-aminophenyl)propoxy]ethoxy]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCCc1ccccc1N |
| InChI | InChI=1S/C18H30N2O4/c1-18(2,3)24-17(21)20-10-12-23-14-13-22-11-6-8-15-7-4-5-9-16(15)19/h4-5,7,9H,6,8,10-14,19H2,1-3H3,(H,20,21) |
| InChIKey | UTGNMEPDAAQOFC-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|