C18H27NO3 — CID 165353198
tert-butyl N-[[2-(2-oxohexyl)phenyl]methyl]carbamate (PubChem CID 165353198) has the molecular formula C18H27NO3 and a molecular weight of 305.42 g/mol. Its IUPAC name is tert-butyl N-[[2-(2-oxohexyl)phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[2-(2-oxohexyl)phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 165353198 |
| Molecular Formula | C18H27NO3 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | tert-butyl N-[[2-(2-oxohexyl)phenyl]methyl]carbamate |
| SMILES | CCCCC(=O)Cc1ccccc1CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H27NO3/c1-5-6-11-16(20)12-14-9-7-8-10-15(14)13-19-17(21)22-18(2,3)4/h7-10H,5-6,11-13H2,1-4H3,(H,19,21) |
| InChIKey | IMBQIKAKSXVBLB-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |