C17H28N2O4S — CID 118512508
tert-butyl N-[[2-[butyl(methylsulfonyl)amino]phenyl]methyl]carbamate (PubChem CID 118512508) has the molecular formula C17H28N2O4S and a molecular weight of 356.49 g/mol. Its IUPAC name is tert-butyl N-[[2-[butyl(methylsulfonyl)amino]phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[2-[butyl(methylsulfonyl)amino]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 118512508 |
| Molecular Formula | C17H28N2O4S |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | tert-butyl N-[[2-[butyl(methylsulfonyl)amino]phenyl]methyl]carbamate |
| SMILES | CCCCN(c1ccccc1CNC(=O)OC(C)(C)C)S(C)(=O)=O |
| InChI | InChI=1S/C17H28N2O4S/c1-6-7-12-19(24(5,21)22)15-11-9-8-10-14(15)13-18-16(20)23-17(2,3)4/h8-11H,6-7,12-13H2,1-5H3,(H,18,20) |
| InChIKey | LRLLUKNTZYDELI-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |