C16H26N2O5S — CID 113070581
tert-butyl N-[2-(2-ethoxy-N-methylsulfonylanilino)ethyl]carbamate (PubChem CID 113070581) has the molecular formula C16H26N2O5S and a molecular weight of 358.46 g/mol. Its IUPAC name is tert-butyl N-[2-(2-ethoxy-N-methylsulfonylanilino)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(2-ethoxy-N-methylsulfonylanilino)ethyl]carbamate |
|---|---|
| PubChem CID | 113070581 |
| Molecular Formula | C16H26N2O5S |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | tert-butyl N-[2-(2-ethoxy-N-methylsulfonylanilino)ethyl]carbamate |
| SMILES | CCOc1ccccc1N(CCNC(=O)OC(C)(C)C)S(C)(=O)=O |
| InChI | InChI=1S/C16H26N2O5S/c1-6-22-14-10-8-7-9-13(14)18(24(5,20)21)12-11-17-15(19)23-16(2,3)4/h7-10H,6,11-12H2,1-5H3,(H,17,19) |
| InChIKey | OAYWCJMAUVVDMA-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |