C15H21F3N2O4S — CID 113070895
tert-butyl N-[2-[N-methylsulfonyl-2-(trifluoromethyl)anilino]ethyl]carbamate (PubChem CID 113070895) has the molecular formula C15H21F3N2O4S and a molecular weight of 382.40 g/mol. Its IUPAC name is tert-butyl N-[2-[N-methylsulfonyl-2-(trifluoromethyl)anilino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[N-methylsulfonyl-2-(trifluoromethyl)anilino]ethyl]carbamate |
|---|---|
| PubChem CID | 113070895 |
| Molecular Formula | C15H21F3N2O4S |
| Molecular Weight | 382.40 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | tert-butyl N-[2-[N-methylsulfonyl-2-(trifluoromethyl)anilino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCN(c1ccccc1C(F)(F)F)S(C)(=O)=O |
| InChI | InChI=1S/C15H21F3N2O4S/c1-14(2,3)24-13(21)19-9-10-20(25(4,22)23)12-8-6-5-7-11(12)15(16,17)18/h5-8H,9-10H2,1-4H3,(H,19,21) |
| InChIKey | SKFRSTVPNMNSRB-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.40 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |