C13H22N2O5S2 — CID 113070587
N-[2-(2-ethoxy-N-methylsulfonylanilino)ethyl]ethanesulfonamide (PubChem CID 113070587) has the molecular formula C13H22N2O5S2 and a molecular weight of 350.46 g/mol. Its IUPAC name is N-[2-(2-ethoxy-N-methylsulfonylanilino)ethyl]ethanesulfonamide.
| Compound Name | N-[2-(2-ethoxy-N-methylsulfonylanilino)ethyl]ethanesulfonamide |
|---|---|
| PubChem CID | 113070587 |
| Molecular Formula | C13H22N2O5S2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | N-[2-(2-ethoxy-N-methylsulfonylanilino)ethyl]ethanesulfonamide |
| SMILES | CCOc1ccccc1N(CCNS(=O)(=O)CC)S(C)(=O)=O |
| InChI | InChI=1S/C13H22N2O5S2/c1-4-20-13-9-7-6-8-12(13)15(21(3,16)17)11-10-14-22(18,19)5-2/h6-9,14H,4-5,10-11H2,1-3H3 |
| InChIKey | DZCODFHMEONZID-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |