C12H20N2O5S2 — CID 113070529
N-[2-(4-methoxy-N-methylsulfonylanilino)ethyl]ethanesulfonamide (PubChem CID 113070529) has the molecular formula C12H20N2O5S2 and a molecular weight of 336.44 g/mol. Its IUPAC name is N-[2-(4-methoxy-N-methylsulfonylanilino)ethyl]ethanesulfonamide.
| Compound Name | N-[2-(4-methoxy-N-methylsulfonylanilino)ethyl]ethanesulfonamide |
|---|---|
| PubChem CID | 113070529 |
| Molecular Formula | C12H20N2O5S2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | N-[2-(4-methoxy-N-methylsulfonylanilino)ethyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)NCCN(c1ccc(OC)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C12H20N2O5S2/c1-4-21(17,18)13-9-10-14(20(3,15)16)11-5-7-12(19-2)8-6-11/h5-8,13H,4,9-10H2,1-3H3 |
| InChIKey | NGNDLALVZHOQLE-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |