C17H22N2O5S2 — CID 113070411
N-[2-(2-methoxy-N-methylsulfonylanilino)ethyl]-2-methylbenzenesulfonamide (PubChem CID 113070411) has the molecular formula C17H22N2O5S2 and a molecular weight of 398.51 g/mol. Its IUPAC name is N-[2-(2-methoxy-N-methylsulfonylanilino)ethyl]-2-methylbenzenesulfonamide.
| Compound Name | N-[2-(2-methoxy-N-methylsulfonylanilino)ethyl]-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 113070411 |
| Molecular Formula | C17H22N2O5S2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | N-[2-(2-methoxy-N-methylsulfonylanilino)ethyl]-2-methylbenzenesulfonamide |
| SMILES | COc1ccccc1N(CCNS(=O)(=O)c1ccccc1C)S(C)(=O)=O |
| InChI | InChI=1S/C17H22N2O5S2/c1-14-8-4-7-11-17(14)26(22,23)18-12-13-19(25(3,20)21)15-9-5-6-10-16(15)24-2/h4-11,18H,12-13H2,1-3H3 |
| InChIKey | ZDZVDJSJPRODBP-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |