C17H22N2O4S2 — CID 113068496
2,5-dimethyl-N-[2-(N-methylsulfonylanilino)ethyl]benzenesulfonamide (PubChem CID 113068496) has the molecular formula C17H22N2O4S2 and a molecular weight of 382.51 g/mol. Its IUPAC name is 2,5-dimethyl-N-[2-(N-methylsulfonylanilino)ethyl]benzenesulfonamide.
| Compound Name | 2,5-dimethyl-N-[2-(N-methylsulfonylanilino)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 113068496 |
| Molecular Formula | C17H22N2O4S2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | 2,5-dimethyl-N-[2-(N-methylsulfonylanilino)ethyl]benzenesulfonamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)NCCN(c2ccccc2)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C17H22N2O4S2/c1-14-9-10-15(2)17(13-14)25(22,23)18-11-12-19(24(3,20)21)16-7-5-4-6-8-16/h4-10,13,18H,11-12H2,1-3H3 |
| InChIKey | FYSIWRPPVZLSMM-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |