C18H24N2O4S2 — CID 113068757
4-ethyl-N-[2-(4-methyl-N-methylsulfonylanilino)ethyl]benzenesulfonamide (PubChem CID 113068757) has the molecular formula C18H24N2O4S2 and a molecular weight of 396.53 g/mol. Its IUPAC name is 4-ethyl-N-[2-(4-methyl-N-methylsulfonylanilino)ethyl]benzenesulfonamide.
| Compound Name | 4-ethyl-N-[2-(4-methyl-N-methylsulfonylanilino)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 113068757 |
| Molecular Formula | C18H24N2O4S2 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | 4-ethyl-N-[2-(4-methyl-N-methylsulfonylanilino)ethyl]benzenesulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)NCCN(c2ccc(C)cc2)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C18H24N2O4S2/c1-4-16-7-11-18(12-8-16)26(23,24)19-13-14-20(25(3,21)22)17-9-5-15(2)6-10-17/h5-12,19H,4,13-14H2,1-3H3 |
| InChIKey | NLKVNTAUZOADGE-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |