C15H24N2O4S2 — CID 113065789
N-[2-[cyclopentyl(methylsulfonyl)amino]ethyl]-2-methylbenzenesulfonamide (PubChem CID 113065789) has the molecular formula C15H24N2O4S2 and a molecular weight of 360.50 g/mol. Its IUPAC name is N-[2-[cyclopentyl(methylsulfonyl)amino]ethyl]-2-methylbenzenesulfonamide.
| Compound Name | N-[2-[cyclopentyl(methylsulfonyl)amino]ethyl]-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 113065789 |
| Molecular Formula | C15H24N2O4S2 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | N-[2-[cyclopentyl(methylsulfonyl)amino]ethyl]-2-methylbenzenesulfonamide |
| SMILES | Cc1ccccc1S(=O)(=O)NCCN(C1CCCC1)S(C)(=O)=O |
| InChI | InChI=1S/C15H24N2O4S2/c1-13-7-3-6-10-15(13)23(20,21)16-11-12-17(22(2,18)19)14-8-4-5-9-14/h3,6-7,10,14,16H,4-5,8-9,11-12H2,1-2H3 |
| InChIKey | GNFDWIRMZAWRBE-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |