C13H19NO2S — CID 115690445
N-(2-cyclobutylethyl)-2-methylbenzenesulfonamide (PubChem CID 115690445) has the molecular formula C13H19NO2S and a molecular weight of 253.37 g/mol. Its IUPAC name is N-(2-cyclobutylethyl)-2-methylbenzenesulfonamide.
| Compound Name | N-(2-cyclobutylethyl)-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 115690445 |
| Molecular Formula | C13H19NO2S |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | N-(2-cyclobutylethyl)-2-methylbenzenesulfonamide |
| SMILES | Cc1ccccc1S(=O)(=O)NCCC1CCC1 |
| InChI | InChI=1S/C13H19NO2S/c1-11-5-2-3-8-13(11)17(15,16)14-10-9-12-6-4-7-12/h2-3,5,8,12,14H,4,6-7,9-10H2,1H3 |
| InChIKey | XTKKCHNJDSLXMV-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |