C15H23ClN2O4S2 — CID 113065880
2-chloro-N-[2-[cyclohexyl(methylsulfonyl)amino]ethyl]benzenesulfonamide (PubChem CID 113065880) has the molecular formula C15H23ClN2O4S2 and a molecular weight of 394.95 g/mol. Its IUPAC name is 2-chloro-N-[2-[cyclohexyl(methylsulfonyl)amino]ethyl]benzenesulfonamide.
| Compound Name | 2-chloro-N-[2-[cyclohexyl(methylsulfonyl)amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 113065880 |
| Molecular Formula | C15H23ClN2O4S2 |
| Molecular Weight | 394.95 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | 2-chloro-N-[2-[cyclohexyl(methylsulfonyl)amino]ethyl]benzenesulfonamide |
| SMILES | CS(=O)(=O)N(CCNS(=O)(=O)c1ccccc1Cl)C1CCCCC1 |
| InChI | InChI=1S/C15H23ClN2O4S2/c1-23(19,20)18(13-7-3-2-4-8-13)12-11-17-24(21,22)15-10-6-5-9-14(15)16/h5-6,9-10,13,17H,2-4,7-8,11-12H2,1H3 |
| InChIKey | PKURNPPEUPZUMA-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.95 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |