C14H22ClN3O3S — CID 113053636
N-[2-[(2-chlorophenyl)sulfonylamino]ethyl]-N-[2-(dimethylamino)ethyl]acetamide (PubChem CID 113053636) has the molecular formula C14H22ClN3O3S and a molecular weight of 347.87 g/mol. Its IUPAC name is N-[2-[(2-chlorophenyl)sulfonylamino]ethyl]-N-[2-(dimethylamino)ethyl]acetamide.
| Compound Name | N-[2-[(2-chlorophenyl)sulfonylamino]ethyl]-N-[2-(dimethylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 113053636 |
| Molecular Formula | C14H22ClN3O3S |
| Molecular Weight | 347.87 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | N-[2-[(2-chlorophenyl)sulfonylamino]ethyl]-N-[2-(dimethylamino)ethyl]acetamide |
| SMILES | CC(=O)N(CCNS(=O)(=O)c1ccccc1Cl)CCN(C)C |
| InChI | InChI=1S/C14H22ClN3O3S/c1-12(19)18(11-10-17(2)3)9-8-16-22(20,21)14-7-5-4-6-13(14)15/h4-7,16H,8-11H2,1-3H3 |
| InChIKey | QFQUWBBECZLNOJ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.87 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |