C14H24ClN3O4S2 — CID 113066442
2-chloro-N-[2-[3-(dimethylamino)propyl-methylsulfonylamino]ethyl]benzenesulfonamide (PubChem CID 113066442) has the molecular formula C14H24ClN3O4S2 and a molecular weight of 397.95 g/mol. Its IUPAC name is 2-chloro-N-[2-[3-(dimethylamino)propyl-methylsulfonylamino]ethyl]benzenesulfonamide.
| Compound Name | 2-chloro-N-[2-[3-(dimethylamino)propyl-methylsulfonylamino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 113066442 |
| Molecular Formula | C14H24ClN3O4S2 |
| Molecular Weight | 397.95 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | 2-chloro-N-[2-[3-(dimethylamino)propyl-methylsulfonylamino]ethyl]benzenesulfonamide |
| SMILES | CN(C)CCCN(CCNS(=O)(=O)c1ccccc1Cl)S(C)(=O)=O |
| InChI | InChI=1S/C14H24ClN3O4S2/c1-17(2)10-6-11-18(23(3,19)20)12-9-16-24(21,22)14-8-5-4-7-13(14)15/h4-5,7-8,16H,6,9-12H2,1-3H3 |
| InChIKey | LBOBLTTUEOLIAM-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.95 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |