C16H26ClN3O3S — CID 113138353
N-[(2-chlorophenyl)methyl]-3-[3-(dimethylamino)propyl-methylsulfonylamino]propanamide (PubChem CID 113138353) has the molecular formula C16H26ClN3O3S and a molecular weight of 375.92 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-3-[3-(dimethylamino)propyl-methylsulfonylamino]propanamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-3-[3-(dimethylamino)propyl-methylsulfonylamino]propanamide |
|---|---|
| PubChem CID | 113138353 |
| Molecular Formula | C16H26ClN3O3S |
| Molecular Weight | 375.92 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-3-[3-(dimethylamino)propyl-methylsulfonylamino]propanamide |
| SMILES | CN(C)CCCN(CCC(=O)NCc1ccccc1Cl)S(C)(=O)=O |
| InChI | InChI=1S/C16H26ClN3O3S/c1-19(2)10-6-11-20(24(3,22)23)12-9-16(21)18-13-14-7-4-5-8-15(14)17/h4-5,7-8H,6,9-13H2,1-3H3,(H,18,21) |
| InChIKey | QVKGYRKJOXADEC-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.92 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |