C15H26N4O3S — CID 113138358
3-[3-(dimethylamino)propyl-methylsulfonylamino]-N-(pyridin-4-ylmethyl)propanamide (PubChem CID 113138358) has the molecular formula C15H26N4O3S and a molecular weight of 342.47 g/mol. Its IUPAC name is 3-[3-(dimethylamino)propyl-methylsulfonylamino]-N-(pyridin-4-ylmethyl)propanamide.
| Compound Name | 3-[3-(dimethylamino)propyl-methylsulfonylamino]-N-(pyridin-4-ylmethyl)propanamide |
|---|---|
| PubChem CID | 113138358 |
| Molecular Formula | C15H26N4O3S |
| Molecular Weight | 342.47 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 3-[3-(dimethylamino)propyl-methylsulfonylamino]-N-(pyridin-4-ylmethyl)propanamide |
| SMILES | CN(C)CCCN(CCC(=O)NCc1ccncc1)S(C)(=O)=O |
| InChI | InChI=1S/C15H26N4O3S/c1-18(2)10-4-11-19(23(3,21)22)12-7-15(20)17-13-14-5-8-16-9-6-14/h5-6,8-9H,4,7,10-13H2,1-3H3,(H,17,20) |
| InChIKey | KBGBVZXMOQLHEM-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.47 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |