C16H20N4O3S — CID 113139767
3-[methylsulfonyl(pyridin-2-ylmethyl)amino]-N-(pyridin-4-ylmethyl)propanamide (PubChem CID 113139767) has the molecular formula C16H20N4O3S and a molecular weight of 348.43 g/mol. Its IUPAC name is 3-[methylsulfonyl(pyridin-2-ylmethyl)amino]-N-(pyridin-4-ylmethyl)propanamide.
| Compound Name | 3-[methylsulfonyl(pyridin-2-ylmethyl)amino]-N-(pyridin-4-ylmethyl)propanamide |
|---|---|
| PubChem CID | 113139767 |
| Molecular Formula | C16H20N4O3S |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 3-[methylsulfonyl(pyridin-2-ylmethyl)amino]-N-(pyridin-4-ylmethyl)propanamide |
| SMILES | CS(=O)(=O)N(CCC(=O)NCc1ccncc1)Cc1ccccn1 |
| InChI | InChI=1S/C16H20N4O3S/c1-24(22,23)20(13-15-4-2-3-8-18-15)11-7-16(21)19-12-14-5-9-17-10-6-14/h2-6,8-10H,7,11-13H2,1H3,(H,19,21) |
| InChIKey | UACHJDRJIYLDRA-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |