C18H22N4O4S — CID 113139844
N-(3-acetamidophenyl)-3-[methylsulfonyl(pyridin-2-ylmethyl)amino]propanamide (PubChem CID 113139844) has the molecular formula C18H22N4O4S and a molecular weight of 390.47 g/mol. Its IUPAC name is N-(3-acetamidophenyl)-3-[methylsulfonyl(pyridin-2-ylmethyl)amino]propanamide.
| Compound Name | N-(3-acetamidophenyl)-3-[methylsulfonyl(pyridin-2-ylmethyl)amino]propanamide |
|---|---|
| PubChem CID | 113139844 |
| Molecular Formula | C18H22N4O4S |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | N-(3-acetamidophenyl)-3-[methylsulfonyl(pyridin-2-ylmethyl)amino]propanamide |
| SMILES | CC(=O)Nc1cccc(NC(=O)CCN(Cc2ccccn2)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C18H22N4O4S/c1-14(23)20-15-7-5-8-16(12-15)21-18(24)9-11-22(27(2,25)26)13-17-6-3-4-10-19-17/h3-8,10,12H,9,11,13H2,1-2H3,(H,20,23)(H,21,24) |
| InChIKey | QRHUIRVRIWWQDD-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |