C14H23N3O3S — CID 113139783
N-tert-butyl-3-[methylsulfonyl(pyridin-2-ylmethyl)amino]propanamide (PubChem CID 113139783) has the molecular formula C14H23N3O3S and a molecular weight of 313.42 g/mol. Its IUPAC name is N-tert-butyl-3-[methylsulfonyl(pyridin-2-ylmethyl)amino]propanamide.
| Compound Name | N-tert-butyl-3-[methylsulfonyl(pyridin-2-ylmethyl)amino]propanamide |
|---|---|
| PubChem CID | 113139783 |
| Molecular Formula | C14H23N3O3S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | N-tert-butyl-3-[methylsulfonyl(pyridin-2-ylmethyl)amino]propanamide |
| SMILES | CC(C)(C)NC(=O)CCN(Cc1ccccn1)S(C)(=O)=O |
| InChI | InChI=1S/C14H23N3O3S/c1-14(2,3)16-13(18)8-10-17(21(4,19)20)11-12-7-5-6-9-15-12/h5-7,9H,8,10-11H2,1-4H3,(H,16,18) |
| InChIKey | QGIWBPKSHJOAOL-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |